103411-23-0 Usage
Chemical structure
A pentanone molecule attached to a phenolic group and a bromine atom.
Reactivity
Potentially reactive due to the presence of a bromine atom and a phenolic group.
Applications
May have applications in organic synthesis and chemical reactions.
Intermediate
The presence of a propenyl group makes it a potentially useful intermediate for the synthesis of various organic compounds.
Versatility
A versatile chemical compound with potential applications in various chemical and pharmaceutical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 103411-23-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,3,4,1 and 1 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 103411-23:
(8*1)+(7*0)+(6*3)+(5*4)+(4*1)+(3*1)+(2*2)+(1*3)=60
60 % 10 = 0
So 103411-23-0 is a valid CAS Registry Number.
InChI:InChI=1/C14H17BrO3/c1-2-5-11-6-3-4-7-14(11)18-10-13(17)8-12(16)9-15/h2-4,6-7,13,17H,1,5,8-10H2
