10344-38-4 Usage
General Description
1,2,3,4-Tetrahydro-10-hydroxy-2-methyl-8-pentyl-5H-[1]benzopyrano[4,3-c]pyridin-5-one is a chemical compound with a complex molecular structure. It belongs to the class of benzopyranopyridinones and is a derivative of 5H-[1]benzopyrano[4,3-c]pyridin-5-one. 1,2,3,4-Tetrahydro-10-hydroxy-2-methyl-8-pentyl-5H-[1]benzopyrano[4,3-c]pyridin-5-one contains a hydroxy group, a methyl group, and a pentyl group, adding to its molecular complexity. It has potential biological and pharmacological activities due to its intricate structure, making it a subject of interest for further research in drug discovery and development.
Check Digit Verification of cas no
The CAS Registry Mumber 10344-38-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,3,4 and 4 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 10344-38:
(7*1)+(6*0)+(5*3)+(4*4)+(3*4)+(2*3)+(1*8)=64
64 % 10 = 4
So 10344-38-4 is a valid CAS Registry Number.
InChI:InChI=1/C18H23NO3/c1-3-4-5-6-12-9-15(20)17-14-11-19(2)8-7-13(14)18(21)22-16(17)10-12/h9-10,20H,3-8,11H2,1-2H3