10344-38-4 Usage
Molecular structure
A complex structure belonging to the class of benzopyranopyridinones and is a derivative of 5H-[1]benzopyrano[4,3-c]pyridin-5-one.
Functional groups
Contains a hydroxy group (-OH), a methyl group (-CH3), and a pentyl group (C5H11), which contribute to its molecular complexity.
Biological and pharmacological activities
Due to its intricate structure, it has potential biological and pharmacological activities, making it a subject of interest for further research in drug discovery and development.
Chemical class
It is a part of the benzopyranopyridinone class of compounds, which are known for their diverse range of biological activities.
Potential applications
Given its potential biological and pharmacological activities, 1,2,3,4-Tetrahydro-10-hydroxy-2-methyl-8-pentyl-5H-[1]benzopyrano[4,3-c]pyridin-5-one may be useful in the development of new drugs or therapies for various medical conditions.
Research interest
The compound's complex structure and potential activities make it a valuable target for further research in the fields of chemistry, biology, and pharmacology.
Synthesis
The synthesis of 1,2,3,4-Tetrahydro-10-hydroxy-2-methyl-8-pentyl-5H-[1]benzopyrano[4,3-c]pyridin-5-one may involve multiple steps and require specific reagents and conditions to form the desired molecular structure.
Structural analysis
Techniques such as nuclear magnetic resonance (NMR) spectroscopy, mass spectrometry, and X-ray crystallography can be used to analyze and confirm the structure of 1,2,3,4-Tetrahydro-10-hydroxy-2-methyl-8-pentyl-5H-[1]benzopyrano[4,3-c]pyridin-5-one.
Stability
The stability of 1,2,3,4-Tetrahydro-10-hydroxy-2-methyl-8-pentyl-5H-[1]benzopyrano[4,3-c]pyridin-5-one under various conditions (e.g., temperature, pH, light exposure) may be an important factor to consider for its potential applications.
Solubility
Understanding the solubility of 1,2,3,4-Tetrahydro-10-hydroxy-2-methyl-8-pentyl-5H-[1]benzopyrano[4,3-c]pyridin-5-one in different solvents can help in determining its suitability for various applications, such as drug formulation and delivery.
Check Digit Verification of cas no
The CAS Registry Mumber 10344-38-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,3,4 and 4 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 10344-38:
(7*1)+(6*0)+(5*3)+(4*4)+(3*4)+(2*3)+(1*8)=64
64 % 10 = 4
So 10344-38-4 is a valid CAS Registry Number.
InChI:InChI=1/C18H23NO3/c1-3-4-5-6-12-9-15(20)17-14-11-19(2)8-7-13(14)18(21)22-16(17)10-12/h9-10,20H,3-8,11H2,1-2H3
10344-38-4Relevant academic research and scientific papers
Drugs derived from cannabinoids. 1. Nitrogen analogs, benzopyranopyridines and benzopyranopyrroles
Pars,Granchelli,Razdan,Keller,Teiger,Rosenberg,Harris
, p. 445 - 454 (2007/10/05)
Various nitrogen analogs of Δ(6a,10a) tetrahydrocannabinol were synthesized by a general procedure described in an earlier communication. Minimum effective doses (MED(50's)) and lethal doses (LD(50's)) were determined by a modified Irwin mouse screen afte
