10346-69-7 Usage
General Description
ETHYLENEDIAMINETETRAACETIC ACID, IRON (III), MONOSODIUM SALT is a chemical compound used in various industrial applications, including as a chelating agent to sequester and remove metal ions. It is a complex of ethylenediaminetetraacetic acid (EDTA) and iron (III) ions, with monosodium salt as the counterion. ETHYLENEDIAMINETETRAACETIC ACID, IRON (III), MONOSODIUM SALT is commonly used in the pharmaceutical and food industries as a stabilizer and preservative, as well as in the production of cleaning and personal care products. It can also be used in water treatment processes to remove unwanted metal ions and improve water quality. Additionally, it plays a role in analytical chemistry and scientific research as a reagent for the determination of metal ion concentrations in various samples.
Check Digit Verification of cas no
The CAS Registry Mumber 10346-69-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,3,4 and 6 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 10346-69:
(7*1)+(6*0)+(5*3)+(4*4)+(3*6)+(2*6)+(1*9)=77
77 % 10 = 7
So 10346-69-7 is a valid CAS Registry Number.
InChI:InChI=1/C10H16N2O8.Fe.Na/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);;/q;+3;+1/p-4