103464-79-5 Usage
Uses
Used in Pharmaceutical Industry:
(4-Methoxy-Benzyl)-(2-Methoxy-Ethyl)-Amine is used as an intermediate in the synthesis of various pharmaceuticals for its ability to contribute to the development of new drugs and enhance the properties of existing ones.
Used in Organic Compounds Synthesis:
It serves as a building block in the production of advanced materials and fine chemicals, playing a crucial role in the creation of complex organic molecules.
Used in Organic Synthesis:
(4-Methoxy-Benzyl)-(2-Methoxy-Ethyl)-Amine is utilized in organic synthesis for its potential to form a wide range of chemical compounds, contributing to the advancement of chemical research and development.
Used in Drug Discovery:
It may have applications in the field of drug discovery, where its unique properties can aid in the identification and development of novel therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 103464-79-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,3,4,6 and 4 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 103464-79:
(8*1)+(7*0)+(6*3)+(5*4)+(4*6)+(3*4)+(2*7)+(1*9)=105
105 % 10 = 5
So 103464-79-5 is a valid CAS Registry Number.
InChI:InChI=1/C11H17NO2/c1-13-8-7-12-9-10-3-5-11(14-2)6-4-10/h3-6,12H,7-9H2,1-2H3
