103478-75-7 Usage
Uses
Used in Pharmaceutical Industry:
1-(1-hydroxy-2-propylamino)-3-(1-naphthoxy)-2-propanol is used as a therapeutic agent for the treatment of cardiovascular conditions due to its beta-adrenergic receptor antagonist activity. Its ability to block adrenaline's action on beta receptors can help in lowering blood pressure and heart rate, making it a potential candidate for conditions such as hypertension, arrhythmias, and heart failure.
Used in Research and Development:
In the field of medical research, 1-(1-hydroxy-2-propylamino)-3-(1-naphthoxy)-2-propanol serves as a valuable compound for studying the effects of beta-adrenergic receptor antagonists on the cardiovascular system. This can lead to a better understanding of the mechanisms underlying various heart conditions and the development of more effective treatments.
Used in Drug Design and Synthesis:
The unique structure of 1-(1-hydroxy-2-propylamino)-3-(1-naphthoxy)-2-propanol makes it a useful starting point for the design and synthesis of new drugs with improved pharmacological properties. Its hydroxy, propylamino, and naphthoxy groups can be modified or used as templates to create novel compounds with enhanced efficacy and selectivity for targeted cardiovascular conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 103478-75-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,3,4,7 and 8 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 103478-75:
(8*1)+(7*0)+(6*3)+(5*4)+(4*7)+(3*8)+(2*7)+(1*5)=117
117 % 10 = 7
So 103478-75-7 is a valid CAS Registry Number.
InChI:InChI=1/C16H21NO3/c1-12(10-18)17-9-14(19)11-20-16-8-4-6-13-5-2-3-7-15(13)16/h2-8,12,14,17-19H,9-11H2,1H3/t12-,14+/m0/s1
