10357-91-2 Usage
Uses
Used in Chemical Industry:
2,6-Dihydroxynicolinic acid is used as a chelating agent for metal ions, for its ability to form stable complexes with various metals, which is crucial in applications requiring the management of metal ion concentrations.
Used in Material Science:
In the synthesis of coordination polymers and metal-organic frameworks, 2,6-Dihydroxynicolinic acid serves as a building block, contributing to the development of new materials with specific properties and potential applications in areas such as catalysis, gas storage, and drug delivery.
Used in Pharmaceutical and Therapeutic Applications:
2,6-Dihydroxynicolinic acid is being investigated for its potential antioxidant and anti-inflammatory properties, making it a candidate for therapeutic applications in the treatment of various diseases where these properties can be beneficial.
Check Digit Verification of cas no
The CAS Registry Mumber 10357-91-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,3,5 and 7 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 10357-91:
(7*1)+(6*0)+(5*3)+(4*5)+(3*7)+(2*9)+(1*1)=82
82 % 10 = 2
So 10357-91-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H5NO4/c8-4-2-1-3(6(10)11)5(9)7-4/h1-2H,(H,10,11)(H2,7,8,9)
