10357-91-2 Usage
General Description
2,6-Dihydroxynicolinic acid is a chemical compound with a molecular formula C6H5NO4. It is a derivative of nicotinic acid and is often used as a chelating agent for metal ions. 2,6-Dihydroxynicolinic acid is known for its ability to form stable complexes with various metals, including copper, iron, and zinc. It is also used in the synthesis of coordination polymers and metal-organic frameworks. Additionally, 2,6-Dihydroxynicolinic acid has exhibited potential antioxidant and anti-inflammatory properties, which have led to its investigation for potential therapeutic applications in the treatment of various diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 10357-91-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,3,5 and 7 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 10357-91:
(7*1)+(6*0)+(5*3)+(4*5)+(3*7)+(2*9)+(1*1)=82
82 % 10 = 2
So 10357-91-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H5NO4/c8-4-2-1-3(6(10)11)5(9)7-4/h1-2H,(H,10,11)(H2,7,8,9)