103583-08-0 Usage
Uses
Used in Pharmaceutical Industry:
6-amino-alpha-(((1-methyl-3-phenylpropyl)amino)methyl)-3-pyridine methanol is used as a potential pharmaceutical compound for its possible medicinal properties. The presence of various functional groups and the substituted phenylpropylamine moiety suggests that it may have therapeutic applications, warranting further investigation into its efficacy and safety.
Used in Drug Discovery:
In the field of drug discovery, 6-amino-alpha-(((1-methyl-3-phenylpropyl)amino)methyl)-3-pyridine methanol serves as a candidate molecule for the development of new drugs. Its unique structure and functional groups may offer novel mechanisms of action or interactions with biological targets, providing opportunities for the creation of innovative therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 103583-08-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,3,5,8 and 3 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 103583-08:
(8*1)+(7*0)+(6*3)+(5*5)+(4*8)+(3*3)+(2*0)+(1*8)=100
100 % 10 = 0
So 103583-08-0 is a valid CAS Registry Number.
InChI:InChI=1/C17H23N3O/c1-13(7-8-14-5-3-2-4-6-14)19-12-16(21)15-9-10-17(18)20-11-15/h2-6,9-11,13,16,19,21H,7-8,12H2,1H3,(H2,18,20)
