103585-71-3 Usage
Uses
Used in Organic Synthesis:
4-Chloro-5-fluoroindolin-2-one is used as a reagent in organic synthesis for its ability to participate in reactions that require specific functional groups, such as chlorine and fluorine atoms. Its unique structure allows it to be a key component in the creation of complex organic molecules.
Used in Pharmaceutical Industry:
4-Chloro-5-fluoroindolin-2-one is used as a building block in the pharmaceutical industry for the synthesis of various pharmaceuticals and biologically active compounds. Its structure and properties make it a promising candidate for the development of new drugs with potential therapeutic applications.
Used in Drug Discovery and Development:
4-Chloro-5-fluoroindolin-2-one is used in drug discovery and development as a starting material or intermediate in the synthesis of novel compounds with potential therapeutic effects. Its presence of chlorine and fluorine atoms can influence the pharmacokinetic and pharmacodynamic properties of the resulting compounds, making it a valuable asset in the search for new drugs.
Check Digit Verification of cas no
The CAS Registry Mumber 103585-71-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,3,5,8 and 5 respectively; the second part has 2 digits, 7 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 103585-71:
(8*1)+(7*0)+(6*3)+(5*5)+(4*8)+(3*5)+(2*7)+(1*1)=113
113 % 10 = 3
So 103585-71-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H5ClFNO/c9-8-4-3-7(12)11-6(4)2-1-5(8)10/h1-2H,3H2,(H,11,12)
