103597-89-3 Usage
General Description
(Diphenylphosphinyl)acetic acid hydrazide mono(di-2-propenylphosphinate) is a chemical compound with the molecular formula C18H21N2O3P2. It is used as a ligand in the synthesis of various metal complexes and catalysts. (Diphenylphosphinyl)acetic acid hydrazide mono(di-2-propenylphosphinat e) has been studied for its potential applications in coordination chemistry and catalysis. It is known for its ability to form stable complexes with various metals, making it valuable in the development of new materials and chemical processes. The compound's unique structure and properties make it a promising candidate for further research and potential industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 103597-89-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,3,5,9 and 7 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 103597-89:
(8*1)+(7*0)+(6*3)+(5*5)+(4*9)+(3*7)+(2*8)+(1*9)=133
133 % 10 = 3
So 103597-89-3 is a valid CAS Registry Number.
InChI:InChI=1/C14H15N2O2P.C6H11O2P/c15-16-18-14(17)11-19(12-7-3-1-4-8-12)13-9-5-2-6-10-13;1-3-5-9(7,8)6-4-2/h1-10,16H,11,15H2;3-4H,1-2,5-6H2,(H,7,8)
