103692-55-3 Usage
General Description
2,5,6-trihydroxy-9H-fluorene-9-methanamine is a chemical compound with the molecular formula C16H13NO3. It is a derivative of fluorene with three hydroxyl groups and a methanamine group attached to the ninth carbon. 2,5,6-trihydroxy-9H-fluorene-9-methanamine is a synthetic derivative of fluorene, and it is primarily used in chemical research and pharmaceutical applications. It may have potential medicinal properties due to the presence of the hydroxyl and methanamine groups, which can interact with biological systems. However, further research is needed to fully understand its potential uses and effects.
Check Digit Verification of cas no
The CAS Registry Mumber 103692-55-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,3,6,9 and 2 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 103692-55:
(8*1)+(7*0)+(6*3)+(5*6)+(4*9)+(3*2)+(2*5)+(1*5)=113
113 % 10 = 3
So 103692-55-3 is a valid CAS Registry Number.
InChI:InChI=1/C14H13NO3/c15-6-11-9-3-4-12(17)14(18)13(9)8-2-1-7(16)5-10(8)11/h1-5,11,16-18H,6,15H2