103733-33-1 Usage
Uses
Used in Pharmaceutical Industry:
L-1,2,3,4-Tetrahydroisoquinoline-3-carboxylic acid methyl ester hydrochloride is used as a building block for the synthesis of various pharmaceutical and biologically active compounds. Its versatile chemical structure allows for the development of new drugs with potential therapeutic applications.
Used in Antioxidant Applications:
L-1,2,3,4-Tetrahydroisoquinoline-3-carboxylic acid methyl ester hydrochloride is used as an antioxidant agent, which can help protect cells from oxidative stress and damage. Its antioxidant properties make it a promising candidate for the development of treatments for various diseases associated with oxidative stress, such as neurodegenerative disorders and cardiovascular diseases.
Used in Neuroprotective Applications:
L-1,2,3,4-Tetrahydroisoquinoline-3-carboxylic acid methyl ester hydrochloride is used as a neuroprotective agent, which can help protect neurons from damage and degeneration. Its neuroprotective properties make it a potential candidate for the development of treatments for neurodegenerative disorders, such as Alzheimer's disease, Parkinson's disease, and multiple sclerosis.
Used in Anti-inflammatory Applications:
L-1,2,3,4-Tetrahydroisoquinoline-3-carboxylic acid methyl ester hydrochloride is used as an anti-inflammatory agent, which can help reduce inflammation and alleviate symptoms associated with inflammatory conditions. Its anti-inflammatory properties make it a potential candidate for the development of treatments for various inflammatory diseases, such as arthritis, asthma, and inflammatory bowel disease.
Check Digit Verification of cas no
The CAS Registry Mumber 103733-33-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,3,7,3 and 3 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 103733-33:
(8*1)+(7*0)+(6*3)+(5*7)+(4*3)+(3*3)+(2*3)+(1*3)=91
91 % 10 = 1
So 103733-33-1 is a valid CAS Registry Number.
InChI:InChI=1/C12H15NO2.ClH/c1-2-15-12(14)11-10-6-4-3-5-9(10)7-8-13-11;/h3-6,11,13H,2,7-8H2,1H3;1H