103755-57-3 Usage
Description
CHEMBRDG-BB 4011498, also known as CTK3H6832, is a chemical compound that belongs to the class of organic compounds known as 1-benzyl-4-piperidyl alkyl ethers. It is an aromatic compound characterized by the presence of a piperidine ring, where the nitrogen atom is connected to a benzyl group and an alkyl chain through an ether linkage. Although there is limited public information available about this specific compound, it serves as a significant starting material in synthetic chemistry and holds potential for research applications in medicine, biology, or materials science. The safety and toxicology details of CHEMBRDG-BB 4011498 are not publicly disclosed.
Uses
Used in Synthetic Chemistry:
CHEMBRDG-BB 4011498 is used as a starting material for the synthesis of various organic compounds. Its unique structure, featuring a benzyl group and an alkyl chain connected to a piperidine ring via an ether linkage, makes it a valuable precursor in the development of new chemical entities.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, CHEMBRDG-BB 4011498 is utilized as a building block for the design and synthesis of potential drug candidates. Its structural features may contribute to the development of novel therapeutic agents with improved pharmacological properties.
Used in Biological Research:
CHEMBRDG-BB 4011498 can be employed in biological research to investigate its interactions with biological targets, such as enzymes, receptors, or other macromolecules. This may lead to the discovery of new biological activities or mechanisms of action, contributing to the advancement of our understanding of various biological processes.
Used in Materials Science:
In materials science, CHEMBRDG-BB 4011498 may be explored for its potential applications in the development of new materials with unique properties. Its aromatic nature and the presence of a piperidine ring could contribute to the creation of materials with specific characteristics, such as improved stability, solubility, or conductivity.
Check Digit Verification of cas no
The CAS Registry Mumber 103755-57-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,3,7,5 and 5 respectively; the second part has 2 digits, 5 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 103755-57:
(8*1)+(7*0)+(6*3)+(5*7)+(4*5)+(3*5)+(2*5)+(1*7)=113
113 % 10 = 3
So 103755-57-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H9N3O/c10-7-3-1-6(2-4-7)8-5-9(13)12-11-8/h1-4H,5,10H2,(H,12,13)
