103775-11-7 Usage
Description
[3S-[2[R(S)]],3S]-2-[2-[[l(Ethoxycarbonyl)-3-phenylpropyl] aMino]-l-oxopropyl]-1,2,3,4-tetrahydro-6,7-diMethoxy-3-isoquinolinecarboxylic Acid is a complex organic compound characterized by a tetrahydroisoquinoline structure. It features amino and oxo functional groups, along with ethoxycarbonyl and phenyl substituents. This unique chemical structure endows the compound with potential pharmacological properties, making it a promising candidate for the development of new pharmaceuticals. However, further research is required to fully explore its properties and possible applications.
Uses
Used in Pharmaceutical Industry:
[3S-[2[R(S)]],3S]-2-[2-[[l(Ethoxycarbonyl)-3-phenylpropyl] aMino]-l-oxopropyl]-1,2,3,4-tetrahydro-6,7-diMethoxy-3-isoquinolinecarboxylic Acid is used as a potential pharmaceutical agent due to its unique chemical structure and potential pharmacological properties. Its synthesis and study may contribute to the development of new drugs for various medical conditions.
(Note: Since the provided materials do not specify particular applications or industries for this compound, the use case listed above is a general statement based on the potential pharmacological properties mentioned. More specific applications would require further research and data.)
Check Digit Verification of cas no
The CAS Registry Mumber 103775-11-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,3,7,7 and 5 respectively; the second part has 2 digits, 1 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 103775-11:
(8*1)+(7*0)+(6*3)+(5*7)+(4*7)+(3*5)+(2*1)+(1*1)=107
107 % 10 = 7
So 103775-11-7 is a valid CAS Registry Number.
InChI:InChI=1S/C27H34N2O7/c1-5-36-27(33)21(12-11-18-9-7-6-8-10-18)28-17(2)25(30)29-16-20-15-24(35-4)23(34-3)14-19(20)13-22(29)26(31)32/h6-10,14-15,17,21-22,28H,5,11-13,16H2,1-4H3,(H,31,32)/t17-,21+,22+/m1/s1
103775-11-7Relevant articles and documents
PROCESS FOR THE PREPARATION OF AMIDES OF N-[1-(S)-(ETHOXYCARBONYL)-3-PHENYLPROPYL]-L-ALANINE
-
Page/Page column 4; 20, (2015/01/07)
A process for the production of amides of N-[1-(S)-(ethoxycarbonyl)-3-phenylpropyl]-L-alanine is described. The process can be used for the production of key intermediates and finally the ACE inhibitors such as Ramipril, Enalapril, Quinapril, Trandolapril, Delapril and Moexipril starting from N-[1-(S)-(ethoxycarbonyl)-3-phenylpropyl]-L-alanine by the reaction with the appropriate amines.