103796-44-7 Usage
Uses
Used in Pharmaceutical Industry:
4-Amino-3,5-dimethyl-benzamide is used as a key intermediate in the development of new drugs, leveraging its biological activities for therapeutic purposes.
Used in Research Laboratories:
In research settings, 4-amino-3,5-dimethyl-benzamide is utilized to study its potential applications across various fields, including its antifungal and antibacterial properties, to explore its broader utility in scientific and medical domains.
Used in Material Development:
4-AMINO-3,5-DIMETHYL-BENZAMIDE has potential applications in the development of new materials, where its chemical properties can contribute to the creation of innovative and improved materials for various industries.
Used in Organic Synthesis:
As a chemical building block, 4-amino-3,5-dimethyl-benzamide is instrumental in the synthesis of complex organic compounds, playing a significant role in advancing chemical research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 103796-44-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,3,7,9 and 6 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 103796-44:
(8*1)+(7*0)+(6*3)+(5*7)+(4*9)+(3*6)+(2*4)+(1*4)=127
127 % 10 = 7
So 103796-44-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H12N2O/c1-5-3-7(9(11)12)4-6(2)8(5)10/h3-4H,10H2,1-2H3,(H2,11,12)
