103867-06-7 Usage
Properties
1. Natural product
2. Derived from Streptomyces bacterium
3. Thiopeptide antibiotic
4. Structurally complex core with multiple sulfur atoms
5. Promising anti-cancer properties
6. Antibacterial activity against gram-positive bacteria
Specific content
1. Unique chemical structure
2. Potent cytotoxic activity against breast, lung, and colon cancer cell lines
3. Potential candidate for novel anti-cancer drugs
4. Antibacterial activity against a range of gram-positive bacteria
5. Interesting target for further research
6. Potential pharmaceutical development
Check Digit Verification of cas no
The CAS Registry Mumber 103867-06-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,3,8,6 and 7 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 103867-06:
(8*1)+(7*0)+(6*3)+(5*8)+(4*6)+(3*7)+(2*0)+(1*6)=117
117 % 10 = 7
So 103867-06-7 is a valid CAS Registry Number.
InChI:InChI=1/C20H36N8O7/c1-28-6-4-10-13(18(28)32)26-20(24-10)27-17-14(25-12(30)7-9(22)3-2-5-21)16(35-19(23)33)15(31)11(8-29)34-17/h9-11,13-17,29,31H,2-8,21-22H2,1H3,(H2,23,33)(H,25,30)(H2,24,26,27)