10387-35-6 Usage
General Description
Propylenbisdithiocarbamat sodium salt hydrate is a chemical compound used as a fungicide and bactericide. It is often utilized in the agriculture industry to protect crops from various fungal and bacterial infections. Its high efficacy in controlling plant diseases makes it a valuable tool for farmers and gardeners. The compound works by inhibiting the growth and reproduction of harmful pathogens, thus preventing the spread of diseases in plants. Additionally, its water-soluble nature enables easy application through sprays or irrigation systems, ensuring widespread protection for the crops. Overall, Propylenbisdithiocarbamat sodium salt hydrate plays a crucial role in maintaining the health and productivity of agricultural crops.
Check Digit Verification of cas no
The CAS Registry Mumber 10387-35-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,3,8 and 7 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 10387-35:
(7*1)+(6*0)+(5*3)+(4*8)+(3*7)+(2*3)+(1*5)=86
86 % 10 = 6
So 10387-35-6 is a valid CAS Registry Number.
InChI:InChI=1/C5H10N2S4.2Na/c8-4(9)6-2-1-3-7-5(10)11;;/h1-3H2,(H2,6,8,9)(H2,7,10,11);;/q;2*+1/p-2
