103877-80-1 Usage
Uses
Used in Pharmaceutical Industry:
2,5-Difluoro-4-methylbenzoic acid is used as a key intermediate in the synthesis of various pharmaceutical compounds for its unique properties and reactivity. Its presence in the molecule can influence the biological activity and pharmacokinetics of the final drug product, making it a valuable component in drug discovery and development.
Used in Agrochemical Industry:
In the agrochemical sector, 2,5-Difluoro-4-methylbenzoic acid is employed as a precursor in the production of active ingredients for pesticides and herbicides. Its specific structural features contribute to the effectiveness and selectivity of these agrochemicals, enhancing crop protection and yield.
Used in Organic Synthesis:
2,5-Difluoro-4-methylbenzoic acid is utilized as a building block in organic synthesis for the creation of a variety of organic compounds. Its fluorinated and functionalized structure allows for diverse chemical reactions, facilitating the synthesis of complex molecules for various applications in research and industry.
Safety Measures:
When working with 2,5-Difluoro-4-methylbenzoic acid, it is crucial to adhere to proper handling and safety protocols to minimize risks associated with chemical exposure. This includes the use of personal protective equipment, working in well-ventilated areas, and following guidelines for chemical storage and disposal.
Check Digit Verification of cas no
The CAS Registry Mumber 103877-80-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,3,8,7 and 7 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 103877-80:
(8*1)+(7*0)+(6*3)+(5*8)+(4*7)+(3*7)+(2*8)+(1*0)=131
131 % 10 = 1
So 103877-80-1 is a valid CAS Registry Number.
InChI:InChI=1/C8H6F2O2/c1-4-2-7(10)5(8(11)12)3-6(4)9/h2-3H,1H3,(H,11,12)
