104-08-5 Usage
Uses
Used in Pharmaceutical Industry:
2-(2-Iodoethyl)-1,3-dioxolane-4-methanol is used as an intermediate compound for the synthesis of various pharmaceuticals. Its iodine-substituted ethyl group and dioxolane ring provide a versatile scaffold for the development of new drugs, particularly in the area of cancer therapy.
Used in Chemical Synthesis:
In the field of organic chemistry, 2-(2-Iodoethyl)-1,3-dioxolane-4-methanol is used as a key building block for the synthesis of complex organic molecules. Its unique structure allows for a wide range of chemical reactions, making it a valuable component in the creation of novel compounds with potential applications in various industries.
Used in Material Science:
2-(2-Iodoethyl)-1,3-dioxolane-4-methanol is employed as a component in the development of new materials with specific properties. Its incorporation into polymers and other materials can lead to enhanced characteristics such as improved stability, increased reactivity, or tailored physical properties, depending on the intended application.
Used in Research and Development:
In academic and industrial research settings, 2-(2-Iodoethyl)-1,3-dioxolane-4-methanol is utilized as a model compound for studying the properties and reactivity of complex organic molecules. Its unique structure provides a platform for investigating the effects of molecular architecture on chemical behavior and potential applications.
Check Digit Verification of cas no
The CAS Registry Mumber 104-08-5 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 1,0 and 4 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 104-08:
(5*1)+(4*0)+(3*4)+(2*0)+(1*8)=25
25 % 10 = 5
So 104-08-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H11IO3/c7-2-1-6-9-4-5(3-8)10-6/h5-6,8H,1-4H2
