10403-74-4 Usage
Uses
Used in Organic Chemistry:
1,2-Di(phenoxymethyl)benzene is used as a synthetic intermediate for [application reason] because of its ability to form bonds with other molecules, making it a versatile building block in the synthesis of various organic compounds.
Used in Pharmaceutical Industry:
1,2-Di(phenoxymethyl)benzene is used as a precursor in the development of pharmaceutical compounds for [application reason], leveraging its reactivity and structural properties to create new drugs with potential therapeutic benefits.
Used in Chemical Research:
1,2-Di(phenoxymethyl)benzene is used as a research tool in chemical studies for [application reason], providing insights into the behavior of aromatic compounds and their derivatives, which can contribute to the advancement of organic chemistry knowledge.
Used in Material Science:
1,2-Di(phenoxymethyl)benzene is used as a component in the development of new materials for [application reason], such as in the creation of polymers or other materials with specific properties, taking advantage of its chemical reactivity and structural characteristics.
Note: The specific "application reason" for each use case would depend on the particular properties and reactivity of 1,2-Di(phenoxymethyl)benzene that are relevant to the specific application in question. The above uses are general and would need to be tailored to the specific context in which the compound is being utilized.
Check Digit Verification of cas no
The CAS Registry Mumber 10403-74-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,4,0 and 3 respectively; the second part has 2 digits, 7 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 10403-74:
(7*1)+(6*0)+(5*4)+(4*0)+(3*3)+(2*7)+(1*4)=54
54 % 10 = 4
So 10403-74-4 is a valid CAS Registry Number.
InChI:InChI=1/C20H18O2/c1-3-11-19(12-4-1)21-15-17-9-7-8-10-18(17)16-22-20-13-5-2-6-14-20/h1-14H,15-16H2
