1040682-84-5 Usage
General Description
1H-Pyrrolo[3,2-c]pyridine-4-carboxylic acid is an organic compound and a specific type of pyrrolopyridine, which are heat-sensitive materials used in the development of various drugs. This particular chemical exhibits acidic properties due to the presence of a carboxyl group, and its derivatives are found in natural products and biomedical studies. Besides, it is used as a key component in the synthesis of several pharmaceuticals because of its potential biological activity. The exact properties of 1H-Pyrrolo[3,2-c]pyridine-4-carboxylic acid, such as its boiling point, melting point, and specific optical rotation, can depend on the specific characterization methods used in lab conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 1040682-84-5 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,0,4,0,6,8 and 2 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 1040682-84:
(9*1)+(8*0)+(7*4)+(6*0)+(5*6)+(4*8)+(3*2)+(2*8)+(1*4)=125
125 % 10 = 5
So 1040682-84-5 is a valid CAS Registry Number.
InChI:InChI=1S/C8H6N2O2/c11-8(12)7-5-1-3-9-6(5)2-4-10-7/h1-4,9H,(H,11,12)
