10413-45-3 Usage
Chemical compound
A complex molecule with a unique structure.
Pyrrolidine derivative
Contains a pyrrolidine ring, which is a common structural motif in organic chemistry.
Carboxylic acid functional group
Has a -COOH group, which can participate in various chemical reactions and interactions.
Ethoxy-benzyl side chain
Contains an ethoxy-benzyl group attached to the molecule, which may provide specific targeting or binding properties.
Organic synthesis
Used as a building block in the creation of new organic compounds.
Pharmaceutical research
Potentially useful in the development of new medications and biologically active compounds due to its unique structure and functional groups.
Biological activity
May possess biological activity, making it a candidate for further study in the context of drug development.
Versatile building block
Its intricate molecular structure and functional groups allow for a wide range of applications in chemical and pharmaceutical research.
Check Digit Verification of cas no
The CAS Registry Mumber 10413-45-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,4,1 and 3 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 10413-45:
(7*1)+(6*0)+(5*4)+(4*1)+(3*3)+(2*4)+(1*5)=53
53 % 10 = 3
So 10413-45-3 is a valid CAS Registry Number.
InChI:InChI=1/C14H17NO4/c1-2-19-12-5-3-10(4-6-12)8-15-9-11(14(17)18)7-13(15)16/h3-6,11H,2,7-9H2,1H3,(H,17,18)
