10414-68-3 Usage
Uses
Used in Organic Synthesis:
((4-methoxybenzoyl)oxy)acetic acid is used as a reagent in organic synthesis for the preparation of various organic compounds. Its unique chemical structure allows for the creation of a wide range of products, making it a valuable asset in this field.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, ((4-methoxybenzoyl)oxy)acetic acid is used as a building block for the synthesis of active pharmaceutical ingredients. Its potential applications in this area are vast, given its ability to contribute to the development of new and effective medications.
Used in Agrochemical Industry:
Similarly, in the agrochemical industry, ((4-methoxybenzoyl)oxy)acetic acid serves as a building block for the synthesis of agricultural chemicals. Its role in this sector is crucial for the production of compounds that can enhance crop protection and yield.
Used in Materials Science:
((4-methoxybenzoyl)oxy)acetic acid also has potential applications in materials science. Its unique properties may contribute to the development of new materials with specific characteristics, useful in various applications.
Used in Biochemistry:
Due to its chemical structure, ((4-methoxybenzoyl)oxy)acetic acid may also find use in biochemistry, where it could be employed in the study and manipulation of biological processes, potentially leading to advancements in this scientific domain.
Check Digit Verification of cas no
The CAS Registry Mumber 10414-68-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,4,1 and 4 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 10414-68:
(7*1)+(6*0)+(5*4)+(4*1)+(3*4)+(2*6)+(1*8)=63
63 % 10 = 3
So 10414-68-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H10O5/c1-14-8-4-2-7(3-5-8)10(13)15-6-9(11)12/h2-5H,6H2,1H3,(H,11,12)
