10414-68-3 Usage
General Description
((4-methoxybenzoyl)oxy)acetic acid is a chemical compound with the molecular formula C10H10O5. It is a derivative of acetic acid with a 4-methoxybenzoyl group attached to the oxygen atom. ((4-methoxybenzoyl)oxy)acetic acid is commonly used in organic synthesis as a reagent for the preparation of various organic compounds. It is also used in the pharmaceutical and agrochemical industries as a building block for the synthesis of active pharmaceutical ingredients and agricultural chemicals. Additionally, it has potential applications in the fields of materials science and biochemistry due to its unique chemical structure and properties. Overall, ((4-methoxybenzoyl)oxy)acetic acid is a versatile compound with a wide range of potential uses in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 10414-68-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,4,1 and 4 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 10414-68:
(7*1)+(6*0)+(5*4)+(4*1)+(3*4)+(2*6)+(1*8)=63
63 % 10 = 3
So 10414-68-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H10O5/c1-14-8-4-2-7(3-5-8)10(13)15-6-9(11)12/h2-5H,6H2,1H3,(H,11,12)