1042-85-9 Usage
General Description
2,4,6(1H,3H,5H)-pyrimidinetrione,1-cyclohexyl-5-ethyl-3-phenyl- is a chemical compound with the molecular formula C15H16N2O3. It is a derivative of pyrimidine and belongs to the class of cyclohexyl compounds. 2,4,6(1H,3H,5H)-Pyrimidinetrione,1-cyclohexyl-5-ethyl-3-phenyl- is typically used in organic synthesis and pharmaceutical research due to its potential pharmacological properties. It has been studied for its potential applications in the treatment of various diseases and medical conditions. The compound's structure and properties make it a versatile building block for the synthesis of diverse organic molecules, making it an important compound in the field of medicinal chemistry and drug discovery.
Check Digit Verification of cas no
The CAS Registry Mumber 1042-85-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,0,4 and 2 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 1042-85:
(6*1)+(5*0)+(4*4)+(3*2)+(2*8)+(1*5)=49
49 % 10 = 9
So 1042-85-9 is a valid CAS Registry Number.
InChI:InChI=1/C18H22N2O3/c1-2-15-16(21)19(13-9-5-3-6-10-13)18(23)20(17(15)22)14-11-7-4-8-12-14/h3,5-6,9-10,14-15H,2,4,7-8,11-12H2,1H3