1042-85-9 Usage
Description
2,4,6(1H,3H,5H)-Pyrimidinetrione,1-cyclohexyl-5-ethyl-3-phenyl-, also known as a cyclohexyl-pyrimidinetrione derivative, is a chemical compound with the molecular formula C15H16N2O3. It is a member of the pyrimidine class and features a cyclohexyl, ethyl, and phenyl group attached to its structure. 2,4,6(1H,3H,5H)-Pyrimidinetrione,1-cyclohexyl-5-ethyl-3-phenylis known for its potential pharmacological properties and is widely used in organic synthesis and pharmaceutical research.
Uses
Used in Organic Synthesis:
2,4,6(1H,3H,5H)-Pyrimidinetrione,1-cyclohexyl-5-ethyl-3-phenylis used as a building block in organic synthesis for the creation of diverse organic molecules. Its unique structure allows for the development of various compounds with different properties and applications.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 2,4,6(1H,3H,5H)-Pyrimidinetrione,1-cyclohexyl-5-ethyl-3-phenylis used as a starting material for the development of new drugs. Its potential pharmacological properties make it a promising candidate for the treatment of various diseases and medical conditions.
Used in Medicinal Chemistry:
2,4,6(1H,3H,5H)-Pyrimidinetrione,1-cyclohexyl-5-ethyl-3-phenylplays a significant role in medicinal chemistry, where it is utilized for the synthesis of bioactive molecules. Its versatile structure enables the design and development of novel therapeutic agents with improved efficacy and selectivity.
Overall, 2,4,6(1H,3H,5H)-Pyrimidinetrione,1-cyclohexyl-5-ethyl-3-phenylis a valuable compound in the fields of organic synthesis, pharmaceutical research, and medicinal chemistry due to its potential applications in the development of new drugs and organic molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 1042-85-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,0,4 and 2 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 1042-85:
(6*1)+(5*0)+(4*4)+(3*2)+(2*8)+(1*5)=49
49 % 10 = 9
So 1042-85-9 is a valid CAS Registry Number.
InChI:InChI=1/C18H22N2O3/c1-2-15-16(21)19(13-9-5-3-6-10-13)18(23)20(17(15)22)14-11-7-4-8-12-14/h3,5-6,9-10,14-15H,2,4,7-8,11-12H2,1H3