1042777-99-0 Usage
Uses
Used in Medicinal Chemistry:
5-(2-(pyrrolidin-1-yl)ethylthio)thiazol-2-amine is used as a building block for the development of new pharmaceuticals due to its complex molecular structure and the presence of biologically active motifs such as the pyrrolidine ring. Its potential to engage in chemical reactions allows for the creation of diverse drug candidates.
Used in Chemical Synthesis:
In the field of chemical synthesis, 5-(2-(pyrrolidin-1-yl)ethylthio)thiazol-2-amine serves as a versatile intermediate for the synthesis of various organic compounds. The amine group facilitates its reactivity in a range of chemical processes, making it a valuable component in the synthesis of complex organic molecules.
Used in Drug Discovery:
5-(2-(pyrrolidin-1-yl)ethylthio)thiazol-2-amine is utilized as a starting material in drug discovery processes, where its unique structural elements can be leveraged to design and optimize compounds with specific therapeutic targets, potentially leading to the development of novel medications.
Used in Biochemical Research:
5-(2-(pyrrolidin-1-yl)ethylthio)thiazol-2-amine is also used in biochemical research as a probe to study the interactions of various biological systems with complex organic molecules, providing insights into molecular recognition and binding processes.
Used in Pharmaceutical Industry:
Within the pharmaceutical industry, 5-(2-(pyrrolidin-1-yl)ethylthio)thiazol-2-amine is employed as a key component in the formulation of innovative drugs, capitalizing on its structural attributes to address unmet medical needs and improve treatment outcomes.
Check Digit Verification of cas no
The CAS Registry Mumber 1042777-99-0 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,0,4,2,7,7 and 7 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 1042777-99:
(9*1)+(8*0)+(7*4)+(6*2)+(5*7)+(4*7)+(3*7)+(2*9)+(1*9)=160
160 % 10 = 0
So 1042777-99-0 is a valid CAS Registry Number.
InChI:InChI=1S/C9H15N3S2/c10-9-11-7-8(14-9)13-6-5-12-3-1-2-4-12/h7H,1-6H2,(H2,10,11)
1042777-99-0Relevant academic research and scientific papers
CYCLOPROPYL COMPOUNDS
-
Page/Page column 3, (2010/07/04)
A compound of the formula: and pharmaceutical compositions for the treatment of diabetes.
