10431-86-4 Usage
Uses
Used in Organic Synthesis:
AZIRIDINE,1-N-BUTYRYL is used as an intermediate in organic synthesis for its reactivity and ability to participate in various chemical reactions. The presence of the butyryl group further contributes to the compound's versatility in creating complex organic molecules.
Used in Pharmaceutical Industry:
AZIRIDINE,1-N-BUTYRYL is utilized as a building block in the development of pharmaceutical compounds due to its unique structural features and potential to form stable derivatives with therapeutic properties.
Used in Chemical Research:
In the field of chemical research, AZIRIDINE,1-N-BUTYRYL serves as a subject of study for understanding the properties and reactions of aziridines, which can lead to the discovery of new applications and insights into their behavior.
Used in Specialty Chemicals Production:
AZIRIDINE,1-N-BUTYRYL is employed in the production of specialty chemicals where its specific reactivity and structural attributes are required for the synthesis of target compounds with unique properties.
Check Digit Verification of cas no
The CAS Registry Mumber 10431-86-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,4,3 and 1 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 10431-86:
(7*1)+(6*0)+(5*4)+(4*3)+(3*1)+(2*8)+(1*6)=64
64 % 10 = 4
So 10431-86-4 is a valid CAS Registry Number.
InChI:InChI=1/C6H11NO/c1-2-3-6(8)7-4-5-7/h2-5H2,1H3
