10466-28-1 Usage
General Description
Alpha-melanocyte stimulating hormone (α-MSH) is a peptide hormone that is produced in the pituitary gland and plays a crucial role in regulating various physiological processes, including skin pigmentation, appetite, and inflammation. It is derived from the proopiomelanocortin (POMC) precursor protein and functions by binding to melanocortin receptors in the brain and peripheral tissues. One of its most well-known functions is its role in regulating melanin production, as it stimulates melanocytes in the skin to produce melanin, which is responsible for skin coloration. Additionally, α-MSH has been studied for its potential therapeutic effects in modulating appetite and energy balance, as well as its anti-inflammatory properties, making it a target for potential treatments for obesity and inflammatory diseases. Overall, alpha-MSH is a multifunctional hormone with diverse physiological roles.
Check Digit Verification of cas no
The CAS Registry Mumber 10466-28-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,4,6 and 6 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 10466-28:
(7*1)+(6*0)+(5*4)+(4*6)+(3*6)+(2*2)+(1*8)=81
81 % 10 = 1
So 10466-28-1 is a valid CAS Registry Number.
InChI:InChI=1/C77H108N20O20S/c1-42(2)64(76(116)117)96-74(114)61-20-13-30-97(61)75(115)54(18-10-11-28-78)87-62(102)38-84-65(105)57(34-46-36-83-50-17-9-8-16-49(46)50)93-66(106)51(19-12-29-82-77(79)80)88-69(109)55(32-44-14-6-5-7-15-44)91-71(111)58(35-47-37-81-41-85-47)94-67(107)52(25-26-63(103)104)89-68(108)53(27-31-118-4)90-73(113)60(40-99)95-70(110)56(33-45-21-23-48(101)24-22-45)92-72(112)59(39-98)86-43(3)100/h5-9,14-17,21-24,36-37,41-42,51-61,64,83,98-99,101H,10-13,18-20,25-35,38-40,78H2,1-4H3,(H,81,85)(H,84,105)(H,86,100)(H,87,102)(H,88,109)(H,89,108)(H,90,113)(H,91,111)(H,92,112)(H,93,106)(H,94,107)(H,95,110)(H,96,114)(H,103,104)(H,116,117)(H4,79,80,82)/t51-,52-,53-,54-,55-,56-,57-,58?,59-,60-,61-,64-/m0/s1