10486-26-7 Usage
Chemical compound
A complex molecule derived from azulene, a naturally occurring compound in chamomile and other plants.
Molecular structure
Contains a cyclohexene ring and a propionate group, with isopropylidene and dimethylazulen functionalities.
Usage
Commonly used in the production of fragrances and flavorings.
Aromatic properties
The compound has a distinctive scent that is often described as warm, woody, and slightly floral.
Ingredient in perfumes and essential oils
Its unique scent makes it a valuable component in the creation of perfumes and essential oils.
Antioxidant properties
The compound is known for its antioxidant properties, which can help protect cells from damage caused by free radicals.
Anti-inflammatory properties
It also has anti-inflammatory properties, making it a valuable ingredient in cosmetics and skincare products.
Natural occurrence
Found in chamomile and other plants, contributing to their unique scents and potential health benefits.
Check Digit Verification of cas no
The CAS Registry Mumber 10486-26-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,4,8 and 6 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 10486-26:
(7*1)+(6*0)+(5*4)+(4*8)+(3*6)+(2*2)+(1*6)=87
87 % 10 = 7
So 10486-26-7 is a valid CAS Registry Number.
InChI:InChI=1/C18H28O2/c1-6-18(19)20-15-7-12(4)16-9-14(11(2)3)10-17(16)13(5)8-15/h7,13,15-17H,6,8-10H2,1-5H3
