10489-75-5 Usage
Uses
Used in Organic Synthesis:
2,3-Dihydro-1,4-dithiino[2,3-c]furan-5,7-dione is used as a key building block in the synthesis of various organic compounds, including:
1. Photoluminescent Three-Dimensional (3-D) AgI Coordination Polymer: DHCA serves as a precursor for the development of photoluminescent 3-D AgI coordination polymers, which have potential applications in optoelectronic devices and materials science.
2. 5,6-Dihydro-1,4-dithiin-2,3-dicarboxylate: DHCA is used in the synthesis of 5,6-dihydro-1,4-dithiin-2,3-dicarboxylate, a compound with potential applications in various chemical and material science fields.
3. CuII and MnII Coordination Complexes: DHCA acts as a primary building block for the formation of CuII and MnII coordination complexes with 5,6-dihydro-1,4-dithiin-2,3-dicarboxylate. These complexes have potential applications in catalysis, magnetism, and other areas of coordination chemistry.
4. 2-Heteroaryl-4,7-dithia-4,5,6,7-tetrahydro-1,3-indandiones: DHCA is utilized in the synthesis of 2-heteroaryl-4,7-dithia-4,5,6,7-tetrahydro-1,3-indandiones, which are compounds with potential applications in pharmaceutical chemistry and drug discovery.
5. 3-Arylmethylene-4,7-dithia-4,5,6,7-tetrahydrophthalides: DHCA is employed in the synthesis of 3-arylmethylene-4,7-dithia-4,5,6,7-tetrahydrophthalides, which are compounds with potential applications in organic chemistry and material science.
Check Digit Verification of cas no
The CAS Registry Mumber 10489-75-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,4,8 and 9 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 10489-75:
(7*1)+(6*0)+(5*4)+(4*8)+(3*9)+(2*7)+(1*5)=105
105 % 10 = 5
So 10489-75-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H4O3S2/c7-5-3-4(6(8)9-5)11-2-1-10-3/h1-2H2
10489-75-5Relevant academic research and scientific papers
Reaction of Carbamoyl-S-benzylcarbodithiolate with Dipolarophiles
Montero, V. Alcazar,Hernandez, I. Tapia,Teresa, J. de Pascual,Moran, J. R.,Olabarrieta, R.
, p. 3664 - 3667 (2007/10/02)
Tetrahydrothiophenes are obtained when dithiooxamide S-methylide is allowed to react with dipolarophiles.The reaction mechanism probably involves a nonconcerted pathway.
1,4-Dithiino(2,3-c)pyrrole derivatives
-
, (2008/06/13)
New compounds of the formula: SPC1 Wherein A is a phenyl, pyridyl, pyridazinyl, 2-, 3- or 4-quinolyl or naphthyridinyl radical, or a said radical substituted by one or two atoms or radicals selected from halogen, alkyl, alkoxy cyano and nitro, R is alkyl, alkenyl or hydroxyalkyl, and n is zero or 1, possess pharmacological properties and are, in particular, active as tranquilisers, anti-convulsant agents, decontracturants and agents to produce hypnosis.