104958-67-0 Usage
Uses
Used in Pharmaceutical Industry:
Benzamide, N-butyl-2-(4-morpholinylcarbonyl)is used as a building block for the synthesis of pharmaceuticals, contributing to the development of new drugs and therapeutic agents. Its chemical structure allows for the creation of compounds with potential medicinal properties, making it an essential component in drug discovery and design.
Used in Agrochemical Industry:
In the agrochemical sector, Benzamide, N-butyl-2-(4-morpholinylcarbonyl)is employed as a precursor in the synthesis of agrochemicals. Its role in creating compounds with pesticidal or herbicidal properties aids in the development of more effective and targeted crop protection solutions.
Used in Biochemical Research:
Benzamide, N-butyl-2-(4-morpholinylcarbonyl)is used as a potent inhibitor of certain enzymes and receptors. This application makes it a valuable tool in biochemical research, where understanding the interactions between compounds and biological targets is crucial for advancing scientific knowledge and developing new therapeutic strategies.
Used in Medicinal Chemistry:
Benzamide, N-butyl-2-(4-morpholinylcarbonyl)is utilized in the field of medicinal chemistry for the development of new therapeutic agents. Its unique properties and functions enable the creation of novel compounds with potential applications in treating various diseases and medical conditions, highlighting its importance in the ongoing pursuit of innovative healthcare solutions.
Check Digit Verification of cas no
The CAS Registry Mumber 104958-67-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,4,9,5 and 8 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 104958-67:
(8*1)+(7*0)+(6*4)+(5*9)+(4*5)+(3*8)+(2*6)+(1*7)=140
140 % 10 = 0
So 104958-67-0 is a valid CAS Registry Number.
InChI:InChI=1/C16H22N2O3/c1-2-3-8-17-15(19)13-6-4-5-7-14(13)16(20)18-9-11-21-12-10-18/h4-7H,2-3,8-12H2,1H3,(H,17,19)
104958-67-0Relevant academic research and scientific papers
REACTION OF N-SUBSTITUTED PHTHALIMIDES AND ISOPHTHALIMIDES WITH SECONDARY AMINES
Ganin, E. V.,Makarov, V. F.,Rozynov, B. V.
, p. 2205 - 2208 (2007/10/02)
The N,N'-substituted diamides of phthalic acid are formed in the reaction of N-substituted phthalimides and isophthalimides with secondary amines.The isophthalimides are stronger agents.Cyclic amines with a medium ring size are acylated so readily that the reaction of 2-bromoethylphthalimide with piperidine leads primarily to the acylation product.
