105112-76-3 Usage
General Description
4,4-BIS(3-AMINOPHENOXY)BIPHENYL(43BAPOBP) is a complex chemical compound with a unique molecular structure. It consists of a biphenyl group, which is a type of aromatic hydrocarbon that has two phenyl rings, connected by two phenoxy groups, which are a type of ether. Additionally, it has an amino group connected to each phenoxy group, responsible for its amine properties. It's a specialty chemical, often used in research and industrial settings, and is likely part of the formula for specific types of polymers or resins. Information about its precise applications, safety measures, and toxicity might not readily available, and further research is suggested.
Check Digit Verification of cas no
The CAS Registry Mumber 105112-76-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,5,1,1 and 2 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 105112-76:
(8*1)+(7*0)+(6*5)+(5*1)+(4*1)+(3*2)+(2*7)+(1*6)=73
73 % 10 = 3
So 105112-76-3 is a valid CAS Registry Number.
InChI:InChI=1/C14H16N2/c1-9-7-11(15)3-5-13(9)14-6-4-12(16)8-10(14)2/h3-8H,15-16H2,1-2H3
