105184-37-0 Usage
General Description
ARG-LYS-GLU-VAL-TYR ACETATE SALT is a compound made up of five amino acids: arginine, lysine, glutamic acid, valine, and tyrosine, which are all linked together. It is commonly found in research and pharmaceutical settings as a salt form, and is used as a component in protein and peptide synthesis. The acetate salt form of this compound allows for improved stability and solubility, making it easier to handle and use in various applications. ARG-LYS-GLU-VAL-TYR ACETATE SALT has been the subject of research for its potential therapeutic and biological activities due to its unique amino acid sequence and chemical properties.
Check Digit Verification of cas no
The CAS Registry Mumber 105184-37-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,5,1,8 and 4 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 105184-37:
(8*1)+(7*0)+(6*5)+(5*1)+(4*8)+(3*4)+(2*3)+(1*7)=100
100 % 10 = 0
So 105184-37-0 is a valid CAS Registry Number.
InChI:InChI=1/C31H51N9O9.2C2H4O2/c1-17(2)25(29(47)39-23(30(48)49)16-18-8-10-19(41)11-9-18)40-28(46)22(12-13-24(42)43)38-27(45)21(7-3-4-14-32)37-26(44)20(33)6-5-15-36-31(34)35;2*1-2(3)4/h8-11,17,20-23,25,41H,3-7,12-16,32-33H2,1-2H3,(H,37,44)(H,38,45)(H,39,47)(H,40,46)(H,42,43)(H,48,49)(H4,34,35,36);2*1H3,(H,3,4)/t20-,21-,22-,23-,25-;;/m0../s1