105242-07-7 Usage
Description
2-(4-Bromophenyl)piperazine, also known as 1-(4-bromophenyl)-4-ethylpiperazine, is a chemical compound that belongs to the benzyl and phenyl piperazine structures. It is characterized by its bromophenyl functional group, which consists of a bromine atom bonded to a phenyl ring that is connected to a piperazine ring. Piperazine rings are recognized for their diverse pharmacological properties, suggesting that 2-(4-Bromophenyl)piperazine may be utilized in the production of various drugs. However, detailed information about its properties, such as boiling or melting points, and its specific applications are not extensively documented. As with all chemicals, it is essential to handle 2-(4-Bromophenyl)piperazine with caution to avoid any adverse or unintended reactions.
Uses
Used in Pharmaceutical Industry:
2-(4-Bromophenyl)piperazine is used as a chemical intermediate for the synthesis of various drugs, leveraging its pharmacological properties derived from the piperazine ring. Its bromophenyl functional group may contribute to the development of new therapeutic agents with potential applications in treating different medical conditions.
Used in Chemical Research:
2-(4-Bromophenyl)piperazine serves as a valuable compound in chemical research, particularly in the study of benzyl and phenyl piperazine structures. Its unique molecular structure allows scientists to explore its potential interactions with other molecules and its role in the formation of new chemical entities.
Used in Drug Development:
2-(4-Bromophenyl)piperazine is employed as a key component in the development of new drugs, thanks to its pharmacological properties and the versatility of its molecular structure. Researchers can modify its structure to create derivatives with improved therapeutic effects or reduced side effects, potentially leading to the discovery of novel medications.
Check Digit Verification of cas no
The CAS Registry Mumber 105242-07-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,5,2,4 and 2 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 105242-07:
(8*1)+(7*0)+(6*5)+(5*2)+(4*4)+(3*2)+(2*0)+(1*7)=77
77 % 10 = 7
So 105242-07-7 is a valid CAS Registry Number.
InChI:InChI=1/C10H13BrN2/c11-9-3-1-8(2-4-9)10-7-12-5-6-13-10/h1-4,10,12-13H,5-7H2
