105242-10-2 Usage
Uses
Used in Pharmaceutical Industry:
2-BIPHENYL-4-YL-PIPERAZINE is used as a key intermediate in the synthesis of pharmaceuticals for its potential to contribute to the development of drugs targeting the central nervous system. Its structural attributes facilitate its role in drug discovery and medicinal chemistry, leading to the creation of novel therapeutic agents.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, 2-BIPHENYL-4-YL-PIPERAZINE serves as a significant compound for research and development. Its unique structural features allow scientists to explore its potential in creating new drug candidates, particularly those aimed at treating disorders of the central nervous system, thus expanding the scope of available treatments.
Check Digit Verification of cas no
The CAS Registry Mumber 105242-10-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,5,2,4 and 2 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 105242-10:
(8*1)+(7*0)+(6*5)+(5*2)+(4*4)+(3*2)+(2*1)+(1*0)=72
72 % 10 = 2
So 105242-10-2 is a valid CAS Registry Number.
InChI:InChI=1/C16H18N2/c1-2-4-13(5-3-1)14-6-8-15(9-7-14)16-12-17-10-11-18-16/h1-9,16-18H,10-12H2
