105391-65-9 Usage
Description
1H-Indazole, 5-(difluoromethoxy)is a chemical compound with the molecular formula C8H6F2N2O. It is a derivative of indazole, a heterocyclic compound with a five-membered ring containing two nitrogen atoms. The incorporation of a difluoromethoxy group into the indazole core structure endows it with unique chemical and physical properties. This modification enhances the compound's stability, reactivity, and solubility, making it a valuable building block for chemical synthesis. 1H-Indazole, 5-(difluoromethoxy)is of interest due to its potential biological activities and applications in various fields, including pharmaceuticals, agrochemicals, and materials science.
Uses
Used in Pharmaceutical Industry:
1H-Indazole, 5-(difluoromethoxy)is used as a key intermediate in the synthesis of pharmaceutical compounds for its potential biological activities. The difluoromethoxy group can improve the compound's pharmacokinetic properties, such as absorption, distribution, metabolism, and excretion, leading to enhanced drug efficacy and safety.
Used in Agrochemical Industry:
1H-Indazole, 5-(difluoromethoxy)is used as a building block in the development of agrochemicals, such as pesticides and herbicides. The unique properties of the difluoromethoxy group can contribute to the compound's effectiveness in controlling pests and weeds, while minimizing environmental impact.
Used in Materials Science:
1H-Indazole, 5-(difluoromethoxy)is used in the development of advanced materials with specific properties, such as high thermal stability, chemical resistance, or optical characteristics. The difluoromethoxy group can influence the compound's interactions with other materials, enabling the creation of novel materials with tailored properties for various applications.
Overall, 1H-Indazole, 5-(difluoromethoxy)is an important chemical compound with potential applications across multiple industries, driven by its unique chemical and physical properties and its role as a valuable building block for chemical synthesis.
Check Digit Verification of cas no
The CAS Registry Mumber 105391-65-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,5,3,9 and 1 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 105391-65:
(8*1)+(7*0)+(6*5)+(5*3)+(4*9)+(3*1)+(2*6)+(1*5)=109
109 % 10 = 9
So 105391-65-9 is a valid CAS Registry Number.
InChI:InChI=1S/C8H6F2N2O/c9-8(10)13-6-1-2-7-5(3-6)4-11-12-7/h1-4,8H,(H,11,12)
