10546-64-2 Usage
General Description
2,6-Dibromo-4-n-propylaniline is a chemical compound with the molecular formula C9H11Br2N. It is a derivative of aniline and contains two bromine atoms and a propyl group attached to the nitrogen atom. 2,6-DIBROMO-4-N-PROPYLANILINE is commonly used as an intermediate in the synthesis of various organic compounds, including pharmaceuticals, dyes, and agrochemicals. It is known for its strong reactivity and is commonly handled with care due to its potential health and safety hazards. 2,6-Dibromo-4-n-propylaniline is also used as a building block in the production of other chemicals and can undergo various chemical reactions to form new compounds with different properties and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 10546-64-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,5,4 and 6 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 10546-64:
(7*1)+(6*0)+(5*5)+(4*4)+(3*6)+(2*6)+(1*4)=82
82 % 10 = 2
So 10546-64-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H11Br2N/c1-2-3-6-4-7(10)9(12)8(11)5-6/h4-5H,2-3,12H2,1H3