10557-55-8 Usage
Description
4-ethylthymine is a DNA lesion that occurs as a mutation in thymine (T412150). It is characterized by the presence of an additional ethyl group attached to the thymine base, which can potentially lead to carcinogenic effects. This unique molecular structure makes it a valuable compound for diagnostic purposes in the field of cancer research.
Uses
Used in Diagnostic Applications:
4-ethylthymine is used as a diagnostic tool for identifying the presence of carcinoma. Its occurrence as a mutation in thymine makes it a significant biomarker for various types of cancer. By detecting the presence of 4-ethylthymine in a sample, medical professionals can gain valuable insights into the presence and progression of cancerous cells.
Used in Cancer Research:
In the field of cancer research, 4-ethylthymine serves as a crucial compound for understanding the molecular mechanisms underlying carcinogenesis. Its role as a potential carcinogenic DNA lesion provides researchers with a valuable tool for studying the genetic mutations and alterations that contribute to the development and progression of cancer.
Used in Pharmaceutical Development:
The unique properties of 4-ethylthymine also make it a promising candidate for the development of new pharmaceuticals targeting cancer. By understanding the molecular interactions and effects of 4-ethylthymine on DNA, researchers can potentially design drugs that target and mitigate the harmful effects of this DNA lesion, thereby offering new treatment options for cancer patients.
Used in Anticancer Drug Development:
4-ethylthymine's potential carcinogenic nature can be leveraged in the development of novel anticancer drugs. By targeting the specific molecular mechanisms associated with this DNA lesion, researchers can design drugs that specifically inhibit or reverse the effects of 4-ethylthymine, potentially leading to more effective cancer treatments.
Check Digit Verification of cas no
The CAS Registry Mumber 10557-55-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,5,5 and 7 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 10557-55:
(7*1)+(6*0)+(5*5)+(4*5)+(3*7)+(2*5)+(1*5)=88
88 % 10 = 8
So 10557-55-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H10N2O2/c1-3-11-6-5(2)4-8-7(10)9-6/h4H,3H2,1-2H3,(H,8,9,10)
