10567-86-9 Usage
Uses
Used in Pharmaceutical Industry:
PHENYLTHIOHYDANTOIN-GLUTAMINE is used as a potential pharmaceutical compound for its unique combination of properties derived from both phenylthiohydantoin and glutamine. Its role in metabolic processes and potential for peptide synthesis could make it a valuable component in the development of new drugs and therapies.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, PHENYLTHIOHYDANTOIN-GLUTAMINE is used as a subject of study for its potential to contribute to the synthesis of new peptide derivatives and other bioactive molecules. Its unique structure and properties may lead to the discovery of novel therapeutic agents and advancements in drug design.
Check Digit Verification of cas no
The CAS Registry Mumber 10567-86-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,5,6 and 7 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 10567-86:
(7*1)+(6*0)+(5*5)+(4*6)+(3*7)+(2*8)+(1*6)=99
99 % 10 = 9
So 10567-86-9 is a valid CAS Registry Number.
InChI:InChI=1/C12H13N3O2S/c13-10(16)7-6-9-11(17)15(12(18)14-9)8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H2,13,16)(H,14,18)
