10581-05-2 Usage
Uses
Used in Pharmaceutical Industry:
1,4-Piperazinedicarboxamide(7CI,9CI) serves as an active pharmaceutical ingredient for the development of medications targeting various medical conditions. Its pharmacological activity is being explored for potential applications as an anti-tumor agent, indicating its use in cancer treatment to inhibit tumor growth and proliferation.
Additionally, 1,4-Piperazinedicarboxamide(7CI,9CI) is considered for the treatment of depression and anxiety disorders, highlighting its potential role in mental health medications, where it may help alleviate symptoms and improve the quality of life for affected individuals.
Used in Organic Synthesis:
Beyond its direct medicinal applications, 1,4-Piperazinedicarboxamide(7CI,9CI) is also utilized as a synthetic intermediate in the preparation of other organic compounds. Its unique structure and functional groups make it a valuable building block in the synthesis of a range of chemical products, contributing to the diversity of applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 10581-05-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,5,8 and 1 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 10581-05:
(7*1)+(6*0)+(5*5)+(4*8)+(3*1)+(2*0)+(1*5)=72
72 % 10 = 2
So 10581-05-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H12N4O2/c7-5(11)9-1-2-10(4-3-9)6(8)12/h1-4H2,(H2,7,11)(H2,8,12)
