105907-34-4 Usage
General Description
3-chloro-N-(4-methylbenzyl)propanamide is a chemical compound that belongs to the class of carboxylic acid amides. It is a white solid with a molecular formula of C11H14ClNO and a molar mass of 213.69 g/mol. 3-chloro-N-(4-methylbenzyl)propanamide is used in organic synthesis and pharmaceutical research as a building block for the synthesis of various molecules. Its chemical structure features a chlorine atom attached to the nitrogen atom of the amide group, and a 4-methylbenzyl group attached to the carbon atom of the amide group. 3-chloro-N-(4-methylbenzyl)propanamide may have potential applications in the development of new pharmaceuticals and agrochemicals due to its unique chemical structure and reactivity.
Check Digit Verification of cas no
The CAS Registry Mumber 105907-34-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,5,9,0 and 7 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 105907-34:
(8*1)+(7*0)+(6*5)+(5*9)+(4*0)+(3*7)+(2*3)+(1*4)=114
114 % 10 = 4
So 105907-34-4 is a valid CAS Registry Number.
InChI:InChI=1/C11H14ClNO/c1-9-2-4-10(5-3-9)8-13-11(14)6-7-12/h2-5H,6-8H2,1H3,(H,13,14)
