105908-43-8 Usage
Description
5-Chloro-2,4,8-trimethylquinoline is a chemical compound that belongs to the quinoline family, characterized by a quinoline ring with a chlorine atom and three methyl groups attached at specific positions. It is known for its potential use in various applications, including pharmaceuticals, agrochemicals, and dyes, due to its biological activity and antimicrobial and antioxidant properties.
Uses
Used in Pharmaceutical Industry:
5-Chloro-2,4,8-trimethylquinoline is used as an intermediate in the synthesis of pharmaceuticals for its potential medical applications. Its unique structure and properties make it a valuable compound in the development of new drugs and treatments.
Used in Agrochemical Industry:
5-CHLORO-2,4,8-TRIMETHYLQUINOLINE is also used as an intermediate in the synthesis of agrochemicals, contributing to the development of effective pesticides and other agricultural products.
Used in Dye Industry:
5-Chloro-2,4,8-trimethylquinoline is utilized in the dye industry for the production of various dyes, taking advantage of its chemical properties to create a range of colors and effects.
Used in Antimicrobial Applications:
Due to its antimicrobial properties, 5-Chloro-2,4,8-trimethylquinoline has potential use in the development of new antimicrobial agents, which can be beneficial in combating resistant bacteria and other microorganisms.
Used in Antioxidant Applications:
The antioxidant properties of 5-Chloro-2,4,8-trimethylquinoline make it a promising candidate for use in the development of antioxidants, which can help protect against oxidative stress and related diseases.
Further research is needed to fully understand the potential benefits and applications of 5-Chloro-2,4,8-trimethylquinoline, as its use in various industries and medical fields is still being explored.
Check Digit Verification of cas no
The CAS Registry Mumber 105908-43-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,5,9,0 and 8 respectively; the second part has 2 digits, 4 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 105908-43:
(8*1)+(7*0)+(6*5)+(5*9)+(4*0)+(3*8)+(2*4)+(1*3)=118
118 % 10 = 8
So 105908-43-8 is a valid CAS Registry Number.
InChI:InChI=1/C12H12ClN/c1-7-4-5-10(13)11-8(2)6-9(3)14-12(7)11/h4-6H,1-3H3