106012-58-2 Usage
Uses
Used in Pharmaceutical Industry:
IMIDAZO[1,2-A]PYRAZINE-3-CARBALDEHYDE is used as a building block for the synthesis of pharmaceutical compounds due to its unique structure and reactivity. It plays a crucial role in the development of new drugs and bioactive molecules, contributing to advancements in medicinal chemistry.
Potential Applications in Other Fields:
While primarily used in the pharmaceutical industry, IMIDAZO[1,2-A]PYRAZINE-3-CARBALDEHYDE may also have potential applications in other fields such as materials science and chemical synthesis. Its unique properties could be harnessed for the development of new materials or as a component in various chemical processes. However, further research and exploration are needed to fully understand and utilize its potential in these areas.
Check Digit Verification of cas no
The CAS Registry Mumber 106012-58-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,6,0,1 and 2 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 106012-58:
(8*1)+(7*0)+(6*6)+(5*0)+(4*1)+(3*2)+(2*5)+(1*8)=72
72 % 10 = 2
So 106012-58-2 is a valid CAS Registry Number.
InChI:InChI=1/C7H5N3O/c11-5-6-3-9-7-4-8-1-2-10(6)7/h1-5H
106012-58-2Relevant academic research and scientific papers
C-3 Hydroxylation of Some Imidazoazines
Teulade, Jean C.,Bonnet, Pierre A.,Rieu, Jean N.,Viols, Henry,Chapat, Jean P.,et al.
, p. 1842 - 1874 (2007/10/02)
Reactions of imidazopyridine, pyrimidine and pyrazine (1)-(3) with formaldehyde or acetaldehyde give the corresponding alcohols and secondary products characterized by 1H and 13C n.m.r.X-Ray crystallographic analysis confirms the structure of (6).The two-step sequence of n-butyllithium and reaction with aldehydes with (2)-(3) does not lead to the alcohols but to n-butyl derivatives with substituents at C(7) and C(8) respectively.
