1060804-48-9 Usage
Uses
Used in Pharmaceutical Synthesis:
5-Hydroxy-pyridine-3-carbaldehyde is utilized as a key intermediate in the production of various pharmaceuticals. Its unique structure allows for the creation of a wide range of biologically active compounds, contributing to the development of new medications.
Used in Agrochemical Production:
In the agrochemical industry, 5-Hydroxy-pyridine-3-carbaldehyde serves as a vital component in the synthesis of pesticides and other crop protection agents, enhancing agricultural productivity and crop protection.
Used in Heterocycle Synthesis:
5-Hydroxy-pyridine-3-carbaldehyde is employed as a precursor in the synthesis of heterocycles, which are common in many biologically active compounds. Its involvement in this process is crucial for the creation of complex molecular structures with potential applications in various fields.
Used in Medicinal Research:
Due to its potential anti-inflammatory and antioxidant properties, 5-Hydroxy-pyridine-3-carbaldehyde is used in medicinal research to explore its therapeutic effects and possible incorporation into treatments for various diseases and conditions.
Used in Chemical Research:
5-Hydroxy-pyridine-3-carbaldehyde's unique characteristics make it a subject of interest in chemical research, where it is studied for its reactivity, potential applications in material science, and its role in the formation of new chemical entities with specific properties.
Check Digit Verification of cas no
The CAS Registry Mumber 1060804-48-9 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,0,6,0,8,0 and 4 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 1060804-48:
(9*1)+(8*0)+(7*6)+(6*0)+(5*8)+(4*0)+(3*4)+(2*4)+(1*8)=119
119 % 10 = 9
So 1060804-48-9 is a valid CAS Registry Number.
InChI:InChI=1S/C6H5NO2/c8-4-5-1-6(9)3-7-2-5/h1-4,9H
