1060809-18-8

Usage

Uses

Used in Organic Synthesis:
4-Fluoro-2-formylpyridine is utilized as a building block in organic synthesis for the creation of complex organic molecules. Its presence of a fluoro and formyl group allows for various chemical reactions, making it a valuable intermediate in the synthesis process.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 4-Fluoro-2-formylpyridine is employed as a key component in the development of pharmaceuticals. Its unique structure and reactivity contribute to the design and synthesis of novel drug candidates with potential therapeutic applications.
Used in Agrochemical Production:
4-Fluoro-2-formylpyridine also finds application in the agrochemical industry, where it serves as a building block for the synthesis of various agrochemicals. Its properties make it suitable for the development of compounds with pesticidal or herbicidal activities.
Used in Heterocyclic Compound Preparation:
4-Fluoro-2-formylpyridine is recognized as a key starting material for the preparation of various heterocyclic compounds. Its role in the synthesis of such compounds highlights its importance in expanding the scope of organic chemistry and the potential for new discoveries in chemical research.

InChI:InChI=1S/C6H4FNO/c7-5-1-2-8-6(3-5)4-9/h1-4H