106447-41-0 Usage
Description
7-Amino-8-oxo-3-(cis-prop-1-enyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid diphenylmethyl ester hydrochloride is a complex organic chemical compound with a unique structure that suggests potential applications in pharmaceutical or antibiotic development. Its name indicates a compound that may possess specific functional groups and structural features, which could be relevant for its reactivity, stability, and interactions with biological systems. Further investigation in scientific literature would be necessary to determine its exact properties, including molecular weight, melting/boiling points, solubility, and any associated safety precautions or potential hazards.
Uses
Given the lack of specific information on the uses of this compound in the provided materials, the following applications are speculative and based on the general nature of similar organic compounds:
Used in Pharmaceutical Industry:
7-Amino-8-oxo-3-(cis-prop-1-enyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid diphenylmethyl ester hydrochloride could be used as an active pharmaceutical ingredient for the development of new drugs, potentially targeting specific diseases or conditions due to its unique molecular structure.
Used in Antibiotic Research:
7-Amino-8-oxo-3-(cis-prop-1-enyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid diphenylmethyl ester hydrochloride might be utilized in the research and development of new antibiotics, given its structural complexity and the possibility of it interacting with bacterial cells in a novel way, offering a new approach to combat antibiotic resistance.
Used in Chemical Synthesis:
As an organic compound, it could serve as a precursor or intermediate in the synthesis of other complex organic molecules, potentially leading to the creation of new materials or compounds with specific applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 106447-41-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,6,4,4 and 7 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 106447-41:
(8*1)+(7*0)+(6*6)+(5*4)+(4*4)+(3*7)+(2*4)+(1*1)=110
110 % 10 = 0
So 106447-41-0 is a valid CAS Registry Number.
InChI:InChI=1/C23H22N2O3S.ClH/c1-2-9-17-14-29-22-18(24)21(26)25(22)19(17)23(27)28-20(15-10-5-3-6-11-15)16-12-7-4-8-13-16;/h2-13,18,20,22H,14,24H2,1H3;1H
106447-41-0Relevant articles and documents
Substituted vinylcephalosporins
-
, (2008/06/13)
β-Lactam compounds of the formula STR1 wherein R5 represent cyclopropyl or methyl, useful as antibiotics.
7-amino-3-propenylcephalosporanic acid and esters thereof
-
, (2008/06/13)
This invention provides novel cephalosporin intermediates, 7β-amino-3-[(Z)-1-propen-1-y1]-3-cephem-4-carboxylic acid and esters thereof having the general formula STR1 wherein the configuration of the 3-propenyl group is Z sometimes referred to as cis- and R is hydrogen or a conventional carboxy-protected group, or a physiologically hydrolyzable esterifying group, and acid addition salts thereof and the metal salts of the foregoing substance wherein R is hydrogen. These compounds are useful as intermediates for preparation of orally active cephalosporins.