106837-89-2 Usage
Uses
Used in Pharmaceutical Drug Development:
2-Amino-4,6-dimethylnicotinic acid is used as a key component in the development of pharmaceutical drugs for the treatment of various medical conditions. Its unique chemical structure allows for the creation of new drug candidates with potential therapeutic benefits.
Used in Chemical Synthesis and Research:
In addition to its pharmaceutical applications, 2-Amino-4,6-dimethylnicotinic acid is utilized in chemical synthesis and research. Its unique properties make it a valuable compound for the development of new chemical entities and for studying various chemical reactions and processes.
Used in Medical Treatments:
2-Amino-4,6-dimethylnicotinic acid is used as a therapeutic agent for the treatment of various medical conditions. Its potential applications in this area are currently being explored by researchers, who are investigating its efficacy and safety in treating specific diseases and disorders.
Check Digit Verification of cas no
The CAS Registry Mumber 106837-89-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,6,8,3 and 7 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 106837-89:
(8*1)+(7*0)+(6*6)+(5*8)+(4*3)+(3*7)+(2*8)+(1*9)=142
142 % 10 = 2
So 106837-89-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H10N2O2/c1-4-3-5(2)10-7(9)6(4)8(11)12/h3H,1-2H3,(H2,9,10)(H,11,12)
