1069-57-4 Usage
Uses
Used in Organic Synthesis:
Guanidine, compound with nitrosopropanedinitrile (1:1) is used as a reagent in organic synthesis for its ability to facilitate various chemical reactions, contributing to the formation of complex organic molecules.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, Guanidine, compound with nitrosopropanedinitrile (1:1) is used as a building block for the preparation of various pharmaceuticals. Its unique chemical properties allow it to be incorporated into the structures of drugs, potentially enhancing their efficacy and therapeutic applications.
Used in Agrochemical Industry:
Similarly, in the agrochemical industry, Guanidine, compound with nitrosopropanedinitrile (1:1) is utilized as a building block for the development of agrochemicals. Its role in creating new molecules can lead to the discovery of more effective pesticides, herbicides, and other agricultural products.
Check Digit Verification of cas no
The CAS Registry Mumber 1069-57-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,0,6 and 9 respectively; the second part has 2 digits, 5 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 1069-57:
(6*1)+(5*0)+(4*6)+(3*9)+(2*5)+(1*7)=74
74 % 10 = 4
So 1069-57-4 is a valid CAS Registry Number.
InChI:InChI=1/C3HN3O.CH5N3/c4-1-3(2-5)6-7;2-1(3)4/h3H;(H5,2,3,4)
