106982-77-8 Usage
General Description
9-Fluoroenylmethoxycarbonylpyroglutamate is a complex chemical compound with a long and specific name. It is a derivative of pyroglutamic acid, which is a naturally occurring amino acid. The presence of the fluorine atom in the compound indicates that it is a fluorinated derivative, which may have specific applications in medicinal chemistry or material science. The methoxy carbonyl group suggests that it may be used as a protecting group in organic synthesis. Overall, 9-fluoroenylmethoxycarbonylpyroglutamate is a specialized chemical compound with potential uses in various fields of science and industry.
Check Digit Verification of cas no
The CAS Registry Mumber 106982-77-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,6,9,8 and 2 respectively; the second part has 2 digits, 7 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 106982-77:
(8*1)+(7*0)+(6*6)+(5*9)+(4*8)+(3*2)+(2*7)+(1*7)=148
148 % 10 = 8
So 106982-77-8 is a valid CAS Registry Number.
InChI:InChI=1/C20H17NO5/c22-18-10-9-17(19(23)24)21(18)20(25)26-11-16-14-7-3-1-5-12(14)13-6-2-4-8-15(13)16/h1-8,16-17H,9-11H2,(H,23,24)/t17-/m0/s1