107073-28-9 Usage
Uses
Used in Pharmaceutical Industry:
3-(1H-Pyrrol-1-yl)-2-thiophenecarbaldehyde is used as an intermediate in the synthesis of pharmaceuticals for its potential to contribute to the development of new drugs. Its unique structure allows for the creation of molecular entities with specific biological activities, making it a promising candidate in medicinal chemistry.
Used in Agrochemical Industry:
In the agrochemical sector, 3-(1H-Pyrrol-1-yl)-2-thiophenecarbaldehyde is utilized as an intermediate in the synthesis of various agrochemicals. Its heterocyclic nature and aromatic properties are leveraged to develop compounds with pesticidal or herbicidal properties, contributing to crop protection and yield enhancement.
Used in Organic Synthesis:
3-(1H-Pyrrol-1-yl)-2-thiophenecarbaldehyde is used as a key building block in organic synthesis for its ability to form a wide range of molecular structures. Its presence in various synthetic pathways is crucial for the production of complex organic compounds with potential applications in different fields, including materials science and specialty chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 107073-28-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,7,0,7 and 3 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 107073-28:
(8*1)+(7*0)+(6*7)+(5*0)+(4*7)+(3*3)+(2*2)+(1*8)=99
99 % 10 = 9
So 107073-28-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H7NOS/c11-7-9-8(3-6-12-9)10-4-1-2-5-10/h1-7H
107073-28-9Relevant academic research and scientific papers
PYRROLOTHIENOPYRIMIDINES II. SYNTHESIS OF 4-AMINOPYRROLOTHIENO (AND ) PYRIMIDINES
Rault, Sylvain,Effi, Yamien,Lancelot, Jean-Charles,Robba, Max
, p. 575 - 578 (2007/10/02)
Cyclization of the appropriate cyanothienylpyrrolylcarboxylic acid azides in boiling ortho-dichlorobenzene conducted to the corresponding aminopyrrolothienopyrimidines.
