1072944-23-0 Usage
General Description
6-Bromo-2,4-dimethylpyridine-3-boronic acid is a chemical compound that belongs to the class of organic substances known as pyridines and derivatives. These are compounds containing a pyridine ring, which is a six-membered aromatic heterocycle made from one nitrogen atom and five carbon atoms. The chemical is often used as a reagent in the synthesis of various pharmaceuticals and bioactive compounds due to its boronic acid functionality. Its chemical formula is C7H8BrBN2O2. Other properties include its molecular weight of approximately 242.97 g/mol, a heavy atom count of 13, and a complexity of 201. Safety and handling precautions for this substance should be observed as it is a potentially hazardous chemical.
Check Digit Verification of cas no
The CAS Registry Mumber 1072944-23-0 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,0,7,2,9,4 and 4 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 1072944-23:
(9*1)+(8*0)+(7*7)+(6*2)+(5*9)+(4*4)+(3*4)+(2*2)+(1*3)=150
150 % 10 = 0
So 1072944-23-0 is a valid CAS Registry Number.
InChI:InChI=1/C7H9BBrNO2/c1-4-3-6(9)10-5(2)7(4)8(11)12/h3,11-12H,1-2H3
