1072944-26-3 Usage
General Description
The chemical "4-(5,5-DIMETHYL-[1,3,2]DIOXABORINAN-2-YL)-1-(TETRAHYDROPYRAN-2-YL)-1H-PYRAZOLE" is a heterocyclic compound containing a boron atom. It is composed of a pyrazole ring fused to a [1,3,2] dioxaborinane ring and a tetrahydropyran ring. 4-(5,5-DIMETHYL-[1,3,2]DIOXABORINAN-2-YL)-1-(TETRAHYDROPYRAN-2-YL)-1H-PYRAZOLE has potential applications in medicinal chemistry and drug development due to its unique structure and potential pharmacological properties. Further research and studies are needed to fully understand and harness the potential of this chemical for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 1072944-26-3 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,0,7,2,9,4 and 4 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 1072944-26:
(9*1)+(8*0)+(7*7)+(6*2)+(5*9)+(4*4)+(3*4)+(2*2)+(1*6)=153
153 % 10 = 3
So 1072944-26-3 is a valid CAS Registry Number.
InChI:InChI=1/C13H21BN2O3/c1-13(2)9-18-14(19-10-13)11-7-15-16(8-11)12-5-3-4-6-17-12/h7-8,12H,3-6,9-10H2,1-2H3